C26H44O6 — CID 101244648
(1R,4S,5S,9S,10R,13R,14S,15S,19R,20R)-4,7,7,10,13,14,17,17,19,20-decamethyl-2-methylidene-6,8,12,16,18-pentaoxatricyclo[13.3.1.15,9]icosan-11-one (PubChem CID 101244648) has the molecular formula C26H44O6 and a molecular weight of 452.63 g/mol. Its IUPAC name is (1R,4S,5S,9S,10R,13R,14S,15S,19R,20R)-4,7,7,10,13,14,17,17,19,20-decamethyl-2-methylidene-6,8,12,16,18-pentaoxatricyclo[13.3.1.15,9]icosan-11-one.
| Compound Name | (1R,4S,5S,9S,10R,13R,14S,15S,19R,20R)-4,7,7,10,13,14,17,17,19,20-decamethyl-2-methylidene-6,8,12,16,18-pentaoxatricyclo[13.3.1.15,9]icosan-11-one |
|---|---|
| PubChem CID | 101244648 |
| Molecular Formula | C26H44O6 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | (1R,4S,5S,9S,10R,13R,14S,15S,19R,20R)-4,7,7,10,13,14,17,17,19,20-decamethyl-2-methylidene-6,8,12,16,18-pentaoxatricyclo[13.3.1.15,9]icosan-11-one |
| SMILES | C=C1C[C@H](C)[C@@H]2OC(C)(C)O[C@@H]([C@@H]2C)[C@@H](C)C(=O)O[C@H](C)[C@H](C)[C@@H]2OC(C)(C)O[C@@H]1[C@@H]2C |
| InChI | InChI=1S/C26H44O6/c1-13-12-14(2)21-17(5)23(32-26(10,11)30-21)18(6)24(27)28-19(7)15(3)22-16(4)20(13)29-25(8,9)31-22/h14-23H,1,12H2,2-11H3/t14-,15-,16-,17+,18+,19+,20-,21-,22-,23-/m0/s1 |
| InChIKey | LKJBSRYSAAZUGI-QUJASINTSA-N |
| XLogP | 5.10 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|