C24H36O8 — CID 146162099
(1S,5S,7S,9S,10R,11S,15S,17S,19S,20R)-5,15-bis(ethenyl)-9,19-dihydroxy-10,20-dimethyl-4,14,21,22-tetraoxatricyclo[15.3.1.17,11]docosane-3,13-dione (PubChem CID 146162099) has the molecular formula C24H36O8 and a molecular weight of 452.54 g/mol. Its IUPAC name is (1S,5S,7S,9S,10R,11S,15S,17S,19S,20R)-5,15-bis(ethenyl)-9,19-dihydroxy-10,20-dimethyl-4,14,21,22-tetraoxatricyclo[15.3.1.17,11]docosane-3,13-dione.
| Compound Name | (1S,5S,7S,9S,10R,11S,15S,17S,19S,20R)-5,15-bis(ethenyl)-9,19-dihydroxy-10,20-dimethyl-4,14,21,22-tetraoxatricyclo[15.3.1.17,11]docosane-3,13-dione |
|---|---|
| PubChem CID | 146162099 |
| Molecular Formula | C24H36O8 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | (1S,5S,7S,9S,10R,11S,15S,17S,19S,20R)-5,15-bis(ethenyl)-9,19-dihydroxy-10,20-dimethyl-4,14,21,22-tetraoxatricyclo[15.3.1.17,11]docosane-3,13-dione |
| SMILES | C=C[C@@H]1C[C@@H]2C[C@H](O)[C@@H](C)[C@H](CC(=O)O[C@H](C=C)C[C@@H]3C[C@H](O)[C@@H](C)[C@H](CC(=O)O1)O3)O2 |
| InChI | InChI=1S/C24H36O8/c1-5-15-7-17-9-19(25)13(3)22(29-17)12-24(28)32-16(6-2)8-18-10-20(26)14(4)21(30-18)11-23(27)31-15/h5-6,13-22,25-26H,1-2,7-12H2,3-4H3/t13-,14-,15-,16-,17-,18-,19+,20+,21+,22+/m1/s1 |
| InChIKey | SQMKTEKUGCMSEM-SWIXAHLVSA-N |
| XLogP | 2.07 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|