C18H32O6 — CID 134846020
methyl 2-[(2R,6S)-6-[(2S,4S,6R,7S)-2,4,6-trihydroxy-7-methylnon-8-enyl]oxan-2-yl]acetate (PubChem CID 134846020) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is methyl 2-[(2R,6S)-6-[(2S,4S,6R,7S)-2,4,6-trihydroxy-7-methylnon-8-enyl]oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,6S)-6-[(2S,4S,6R,7S)-2,4,6-trihydroxy-7-methylnon-8-enyl]oxan-2-yl]acetate |
|---|---|
| PubChem CID | 134846020 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | methyl 2-[(2R,6S)-6-[(2S,4S,6R,7S)-2,4,6-trihydroxy-7-methylnon-8-enyl]oxan-2-yl]acetate |
| SMILES | C=C[C@H](C)[C@H](O)C[C@@H](O)C[C@H](O)C[C@@H]1CCC[C@H](CC(=O)OC)O1 |
| InChI | InChI=1S/C18H32O6/c1-4-12(2)17(21)10-14(20)8-13(19)9-15-6-5-7-16(24-15)11-18(22)23-3/h4,12-17,19-21H,1,5-11H2,2-3H3/t12-,13-,14-,15-,16+,17+/m0/s1 |
| InChIKey | NKOQYAOZUGTOFL-NQLMQOPMSA-N |
| XLogP | 1.56 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|