C31H56O6Si — CID 11364902
(1S,5R,7R,8R,13S,14S)-8-hydroxy-5-[(3R)-3-hydroxy-2-methylpent-4-en-2-yl]-7,14-dimethyl-9-methylidene-13-tri(propan-2-yl)silyloxy-4,15-dioxabicyclo[9.3.1]pentadecan-3-one (PubChem CID 11364902) has the molecular formula C31H56O6Si and a molecular weight of 552.87 g/mol. Its IUPAC name is (1S,5R,7R,8R,13S,14S)-8-hydroxy-5-[(3R)-3-hydroxy-2-methylpent-4-en-2-yl]-7,14-dimethyl-9-methylidene-13-tri(propan-2-yl)silyloxy-4,15-dioxabicyclo[9.3.1]pentadecan-3-one.
| Compound Name | (1S,5R,7R,8R,13S,14S)-8-hydroxy-5-[(3R)-3-hydroxy-2-methylpent-4-en-2-yl]-7,14-dimethyl-9-methylidene-13-tri(propan-2-yl)silyloxy-4,15-dioxabicyclo[9.3.1]pentadecan-3-one |
|---|---|
| PubChem CID | 11364902 |
| Molecular Formula | C31H56O6Si |
| Molecular Weight | 552.87 g/mol |
| Exact Mass | 552.38 |
| IUPAC Name | (1S,5R,7R,8R,13S,14S)-8-hydroxy-5-[(3R)-3-hydroxy-2-methylpent-4-en-2-yl]-7,14-dimethyl-9-methylidene-13-tri(propan-2-yl)silyloxy-4,15-dioxabicyclo[9.3.1]pentadecan-3-one |
| SMILES | C=C[C@@H](O)C(C)(C)[C@H]1C[C@@H](C)[C@@H](O)C(=C)CC2C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)[C@H](CC(=O)O1)O2 |
| InChI | InChI=1S/C31H56O6Si/c1-13-27(32)31(11,12)28-15-22(9)30(34)21(8)14-24-16-26(23(10)25(35-24)17-29(33)36-28)37-38(18(2)3,19(4)5)20(6)7/h13,18-20,22-28,30,32,34H,1,8,14-17H2,2-7,9-12H3/t22-,23+,24?,25+,26+,27-,28-,30+/m1/s1 |
| InChIKey | HTPPTKHXXMWUSD-LWSKFDMZSA-N |
| XLogP | 6.56 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.87 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|