C31H58O7Si — CID 11376557
2-[(2S,3S,4S,6R)-3-methyl-6-[(3R,4R,6R,8R)-3,6,8-trihydroxy-4,7,7-trimethyl-2-methylidenedec-9-enyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetic acid (PubChem CID 11376557) has the molecular formula C31H58O7Si and a molecular weight of 570.88 g/mol. Its IUPAC name is 2-[(2S,3S,4S,6R)-3-methyl-6-[(3R,4R,6R,8R)-3,6,8-trihydroxy-4,7,7-trimethyl-2-methylidenedec-9-enyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetic acid.
| Compound Name | 2-[(2S,3S,4S,6R)-3-methyl-6-[(3R,4R,6R,8R)-3,6,8-trihydroxy-4,7,7-trimethyl-2-methylidenedec-9-enyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 11376557 |
| Molecular Formula | C31H58O7Si |
| Molecular Weight | 570.88 g/mol |
| Exact Mass | 570.40 |
| IUPAC Name | 2-[(2S,3S,4S,6R)-3-methyl-6-[(3R,4R,6R,8R)-3,6,8-trihydroxy-4,7,7-trimethyl-2-methylidenedec-9-enyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetic acid |
| SMILES | C=C[C@@H](O)C(C)(C)[C@H](O)C[C@@H](C)[C@@H](O)C(=C)C[C@@H]1C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)[C@H](CC(=O)O)O1 |
| InChI | InChI=1S/C31H58O7Si/c1-13-27(32)31(11,12)28(33)15-22(9)30(36)21(8)14-24-16-26(23(10)25(37-24)17-29(34)35)38-39(18(2)3,19(4)5)20(6)7/h13,18-20,22-28,30,32-33,36H,1,8,14-17H2,2-7,9-12H3,(H,34,35)/t22-,23+,24-,25+,26+,27-,28-,30+/m1/s1 |
| InChIKey | IKSMUCBGHNPFNF-HLHBSKFESA-N |
| XLogP | 6.08 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.88 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|