C23H42O8Si — CID 11134546
4-[[(2R,3S,5R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxy-3-carboxy-2-methylpropyl]-3,5-dihydroxy-2-methyloxan-2-yl]methyl]pent-4-enoic acid (PubChem CID 11134546) has the molecular formula C23H42O8Si and a molecular weight of 474.67 g/mol. Its IUPAC name is 4-[[(2R,3S,5R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxy-3-carboxy-2-methylpropyl]-3,5-dihydroxy-2-methyloxan-2-yl]methyl]pent-4-enoic acid.
| Compound Name | 4-[[(2R,3S,5R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxy-3-carboxy-2-methylpropyl]-3,5-dihydroxy-2-methyloxan-2-yl]methyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 11134546 |
| Molecular Formula | C23H42O8Si |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 4-[[(2R,3S,5R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxy-3-carboxy-2-methylpropyl]-3,5-dihydroxy-2-methyloxan-2-yl]methyl]pent-4-enoic acid |
| SMILES | C=C(CCC(=O)O)C[C@@]1(C)O[C@@H](CC(C)(CC(=O)O)O[Si](C)(C)C(C)(C)C)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H42O8Si/c1-15(9-10-19(26)27)12-23(6)18(25)11-16(24)17(30-23)13-22(5,14-20(28)29)31-32(7,8)21(2,3)4/h16-18,24-25H,1,9-14H2,2-8H3,(H,26,27)(H,28,29)/t16-,17+,18+,22?,23-/m1/s1 |
| InChIKey | CJDBQLQZCAVSFY-UHTMJCKESA-N |
| XLogP | 3.71 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|