C28H54O10Si — CID 11330674
methyl (2R,3S)-4-[(2R,4S,5S,6S)-6-[(3R)-3-hydroxy-2-methylhex-5-en-2-yl]-4,6-dimethoxy-5-triethylsilyloxyoxan-2-yl]-3-methoxy-2-(methoxymethoxy)butanoate (PubChem CID 11330674) has the molecular formula C28H54O10Si and a molecular weight of 578.82 g/mol. Its IUPAC name is methyl (2R,3S)-4-[(2R,4S,5S,6S)-6-[(3R)-3-hydroxy-2-methylhex-5-en-2-yl]-4,6-dimethoxy-5-triethylsilyloxyoxan-2-yl]-3-methoxy-2-(methoxymethoxy)butanoate.
| Compound Name | methyl (2R,3S)-4-[(2R,4S,5S,6S)-6-[(3R)-3-hydroxy-2-methylhex-5-en-2-yl]-4,6-dimethoxy-5-triethylsilyloxyoxan-2-yl]-3-methoxy-2-(methoxymethoxy)butanoate |
|---|---|
| PubChem CID | 11330674 |
| Molecular Formula | C28H54O10Si |
| Molecular Weight | 578.82 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | methyl (2R,3S)-4-[(2R,4S,5S,6S)-6-[(3R)-3-hydroxy-2-methylhex-5-en-2-yl]-4,6-dimethoxy-5-triethylsilyloxyoxan-2-yl]-3-methoxy-2-(methoxymethoxy)butanoate |
| SMILES | C=CC[C@@H](O)C(C)(C)[C@]1(OC)O[C@H](C[C@H](OC)[C@@H](OCOC)C(=O)OC)C[C@H](OC)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C28H54O10Si/c1-12-16-23(29)27(5,6)28(35-11)25(38-39(13-2,14-3)15-4)22(33-9)18-20(37-28)17-21(32-8)24(26(30)34-10)36-19-31-7/h12,20-25,29H,1,13-19H2,2-11H3/t20-,21+,22+,23-,24-,25+,28-/m1/s1 |
| InChIKey | OSVBSCZXRRYVSX-ROWORWDSSA-N |
| XLogP | 4.05 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|