C29H51IO8Si — CID 155930032
(1S,4R,7R,10R,14R,15S,16S,17R)-10-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-16,17-dihydroxy-1-methoxy-15-methyl-9,18,19-trioxatricyclo[12.3.1.14,7]nonadecan-8-one (PubChem CID 155930032) has the molecular formula C29H51IO8Si and a molecular weight of 682.71 g/mol. Its IUPAC name is (1S,4R,7R,10R,14R,15S,16S,17R)-10-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-16,17-dihydroxy-1-methoxy-15-methyl-9,18,19-trioxatricyclo[12.3.1.14,7]nonadecan-8-one.
| Compound Name | (1S,4R,7R,10R,14R,15S,16S,17R)-10-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-16,17-dihydroxy-1-methoxy-15-methyl-9,18,19-trioxatricyclo[12.3.1.14,7]nonadecan-8-one |
|---|---|
| PubChem CID | 155930032 |
| Molecular Formula | C29H51IO8Si |
| Molecular Weight | 682.71 g/mol |
| Exact Mass | 682.24 |
| IUPAC Name | (1S,4R,7R,10R,14R,15S,16S,17R)-10-[(Z,2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-iodopent-4-enyl]-16,17-dihydroxy-1-methoxy-15-methyl-9,18,19-trioxatricyclo[12.3.1.14,7]nonadecan-8-one |
| SMILES | CO[C@@]12CC[C@H]3CC[C@@H](O3)C(=O)O[C@@H](C[C@@H](C/C=C\I)O[Si](C)(C)C(C)(C)C)CCC[C@@H](O1)[C@@H](C)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C29H51IO8Si/c1-19-23-12-8-10-21(18-22(11-9-17-30)38-39(6,7)28(2,3)4)36-27(33)24-14-13-20(35-24)15-16-29(34-5,37-23)26(32)25(19)31/h9,17,19-26,31-32H,8,10-16,18H2,1-7H3/b17-9-/t19-,20-,21-,22-,23-,24-,25+,26-,29+/m1/s1 |
| InChIKey | CXNBWIBQHWFAHU-ILSOOIAISA-N |
| XLogP | 5.63 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.71 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|