C11H17N3O3 — CID 108844714
2-[[(Z)-3-(butylamino)-2-cyanoprop-2-enoyl]amino]propanoic acid (PubChem CID 108844714) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-[[(Z)-3-(butylamino)-2-cyanoprop-2-enoyl]amino]propanoic acid.
| Compound Name | 2-[[(Z)-3-(butylamino)-2-cyanoprop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 108844714 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-[[(Z)-3-(butylamino)-2-cyanoprop-2-enoyl]amino]propanoic acid |
| SMILES | CCCCN/C=C(/C#N)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C11H17N3O3/c1-3-4-5-13-7-9(6-12)10(15)14-8(2)11(16)17/h7-8,13H,3-5H2,1-2H3,(H,14,15)(H,16,17)/b9-7- |
| InChIKey | VAGKIRKBDRNFLW-CLFYSBASSA-N |
| XLogP | 0.37 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|