C16H25N3O5 — CID 108846237
2-[[(Z)-3-(5-carboxypentylamino)-2-cyanoprop-2-enoyl]amino]-4-methylpentanoic acid (PubChem CID 108846237) has the molecular formula C16H25N3O5 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-[[(Z)-3-(5-carboxypentylamino)-2-cyanoprop-2-enoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[(Z)-3-(5-carboxypentylamino)-2-cyanoprop-2-enoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 108846237 |
| Molecular Formula | C16H25N3O5 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 2-[[(Z)-3-(5-carboxypentylamino)-2-cyanoprop-2-enoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)/C(C#N)=C\NCCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H25N3O5/c1-11(2)8-13(16(23)24)19-15(22)12(9-17)10-18-7-5-3-4-6-14(20)21/h10-11,13,18H,3-8H2,1-2H3,(H,19,22)(H,20,21)(H,23,24)/b12-10- |
| InChIKey | BJZOJKNXYWQJQC-BENRWUELSA-N |
| XLogP | 1.24 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|