C15H20N4O5S — CID 108846465
2-[[(Z)-2-cyano-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]prop-2-enoyl]amino]-4-methylpentanoic acid (PubChem CID 108846465) has the molecular formula C15H20N4O5S and a molecular weight of 368.42 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]prop-2-enoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[(Z)-2-cyano-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]prop-2-enoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 108846465 |
| Molecular Formula | C15H20N4O5S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]prop-2-enoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)/C(C#N)=C\NCCN1C(=O)CSC1=O)C(=O)O |
| InChI | InChI=1S/C15H20N4O5S/c1-9(2)5-11(14(22)23)18-13(21)10(6-16)7-17-3-4-19-12(20)8-25-15(19)24/h7,9,11,17H,3-5,8H2,1-2H3,(H,18,21)(H,22,23)/b10-7- |
| InChIKey | TYMXBIGACYOUMB-YFHOEESVSA-N |
| XLogP | 0.29 |
| TPSA | 139.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|