C26H27N5O3S — CID 108832739
(Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]prop-2-enenitrile (PubChem CID 108832739) has the molecular formula C26H27N5O3S and a molecular weight of 489.60 g/mol. Its IUPAC name is (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]prop-2-enenitrile |
|---|---|
| PubChem CID | 108832739 |
| Molecular Formula | C26H27N5O3S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]prop-2-enenitrile |
| SMILES | N#C/C(=C/NCCN1C(=O)CSC1=O)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H27N5O3S/c27-17-22(18-28-11-12-31-23(32)19-35-26(31)34)25(33)30-15-13-29(14-16-30)24(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-10,18,24,28H,11-16,19H2/b22-18- |
| InChIKey | DHPXDQDRJVJUTD-PYCFMQQDSA-N |
| XLogP | 2.61 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|