C26H27NOS2 — CID 10884565
(3R,4S)-4-[bis(phenylsulfanyl)methyl]-3-ethyl-1-[(1S)-1-phenylethyl]azetidin-2-one (PubChem CID 10884565) has the molecular formula C26H27NOS2 and a molecular weight of 433.64 g/mol. Its IUPAC name is (3R,4S)-4-[bis(phenylsulfanyl)methyl]-3-ethyl-1-[(1S)-1-phenylethyl]azetidin-2-one.
| Compound Name | (3R,4S)-4-[bis(phenylsulfanyl)methyl]-3-ethyl-1-[(1S)-1-phenylethyl]azetidin-2-one |
|---|---|
| PubChem CID | 10884565 |
| Molecular Formula | C26H27NOS2 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | (3R,4S)-4-[bis(phenylsulfanyl)methyl]-3-ethyl-1-[(1S)-1-phenylethyl]azetidin-2-one |
| SMILES | CC[C@H]1C(=O)N([C@@H](C)c2ccccc2)[C@@H]1C(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C26H27NOS2/c1-3-23-24(27(25(23)28)19(2)20-13-7-4-8-14-20)26(29-21-15-9-5-10-16-21)30-22-17-11-6-12-18-22/h4-19,23-24,26H,3H2,1-2H3/t19-,23+,24-/m0/s1 |
| InChIKey | OCNIQHUIMLSPTM-IEXUWNMDSA-N |
| XLogP | 6.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|