C17H21N3O4S — CID 108846638
2-[[(Z)-2-cyano-3-(4-ethoxyanilino)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 108846638) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-(4-ethoxyanilino)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[(Z)-2-cyano-3-(4-ethoxyanilino)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108846638 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-(4-ethoxyanilino)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCOc1ccc(N/C=C(/C#N)C(=O)NC(CCSC)C(=O)O)cc1 |
| InChI | InChI=1S/C17H21N3O4S/c1-3-24-14-6-4-13(5-7-14)19-11-12(10-18)16(21)20-15(17(22)23)8-9-25-2/h4-7,11,15,19H,3,8-9H2,1-2H3,(H,20,21)(H,22,23)/b12-11- |
| InChIKey | XKYWSXFGTWDBFW-QXMHVHEDSA-N |
| XLogP | 2.23 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|