C21H22N4O3S — CID 108846721
2-[[(Z)-3-(4-anilinoanilino)-2-cyanoprop-2-enoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 108846721) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-[[(Z)-3-(4-anilinoanilino)-2-cyanoprop-2-enoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[(Z)-3-(4-anilinoanilino)-2-cyanoprop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108846721 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-[[(Z)-3-(4-anilinoanilino)-2-cyanoprop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)/C(C#N)=C\Nc1ccc(Nc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C21H22N4O3S/c1-29-12-11-19(21(27)28)25-20(26)15(13-22)14-23-16-7-9-18(10-8-16)24-17-5-3-2-4-6-17/h2-10,14,19,23-24H,11-12H2,1H3,(H,25,26)(H,27,28)/b15-14- |
| InChIKey | KNGGALRUQUXQEG-PFONDFGASA-N |
| XLogP | 3.57 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|