C15H15ClN4O5S — CID 108846633
2-[[(Z)-3-(2-chloro-5-nitroanilino)-2-cyanoprop-2-enoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 108846633) has the molecular formula C15H15ClN4O5S and a molecular weight of 398.83 g/mol. Its IUPAC name is 2-[[(Z)-3-(2-chloro-5-nitroanilino)-2-cyanoprop-2-enoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[(Z)-3-(2-chloro-5-nitroanilino)-2-cyanoprop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108846633 |
| Molecular Formula | C15H15ClN4O5S |
| Molecular Weight | 398.83 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2-[[(Z)-3-(2-chloro-5-nitroanilino)-2-cyanoprop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)/C(C#N)=C\Nc1cc([N+](=O)[O-])ccc1Cl)C(=O)O |
| InChI | InChI=1S/C15H15ClN4O5S/c1-26-5-4-12(15(22)23)19-14(21)9(7-17)8-18-13-6-10(20(24)25)2-3-11(13)16/h2-3,6,8,12,18H,4-5H2,1H3,(H,19,21)(H,22,23)/b9-8- |
| InChIKey | SIOPVCYSJCDXQP-HJWRWDBZSA-N |
| XLogP | 2.39 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.83 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|