C13H12Cl2N4O3 — CID 108854083
(Z)-3-(2-chloro-5-nitroanilino)-N-(3-chloropropyl)-2-cyanoprop-2-enamide (PubChem CID 108854083) has the molecular formula C13H12Cl2N4O3 and a molecular weight of 343.17 g/mol. Its IUPAC name is (Z)-3-(2-chloro-5-nitroanilino)-N-(3-chloropropyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(2-chloro-5-nitroanilino)-N-(3-chloropropyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108854083 |
| Molecular Formula | C13H12Cl2N4O3 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | (Z)-3-(2-chloro-5-nitroanilino)-N-(3-chloropropyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/Nc1cc([N+](=O)[O-])ccc1Cl)C(=O)NCCCCl |
| InChI | InChI=1S/C13H12Cl2N4O3/c14-4-1-5-17-13(20)9(7-16)8-18-12-6-10(19(21)22)2-3-11(12)15/h2-3,6,8,18H,1,4-5H2,(H,17,20)/b9-8- |
| InChIKey | VNQOFQIINGPZKH-HJWRWDBZSA-N |
| XLogP | 2.81 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|