C16H17N3O5S — CID 108816132
3-[[(Z)-3-[(1-carboxy-3-methylsulfanylpropyl)amino]-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 108816132) has the molecular formula C16H17N3O5S and a molecular weight of 363.40 g/mol. Its IUPAC name is 3-[[(Z)-3-[(1-carboxy-3-methylsulfanylpropyl)amino]-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-3-[(1-carboxy-3-methylsulfanylpropyl)amino]-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108816132 |
| Molecular Formula | C16H17N3O5S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 3-[[(Z)-3-[(1-carboxy-3-methylsulfanylpropyl)amino]-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | CSCCC(N/C=C(/C#N)C(=O)Nc1cccc(C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C16H17N3O5S/c1-25-6-5-13(16(23)24)18-9-11(8-17)14(20)19-12-4-2-3-10(7-12)15(21)22/h2-4,7,9,13,18H,5-6H2,1H3,(H,19,20)(H,21,22)(H,23,24)/b11-9- |
| InChIKey | PLHWIASBRXBBFI-LUAWRHEFSA-N |
| XLogP | 1.53 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|