C17H20N4O4S — CID 108846732
2-[[(Z)-3-(N-acetyl-3-aminoanilino)-2-cyanoprop-2-enoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 108846732) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is 2-[[(Z)-3-(N-acetyl-3-aminoanilino)-2-cyanoprop-2-enoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[(Z)-3-(N-acetyl-3-aminoanilino)-2-cyanoprop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108846732 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-[[(Z)-3-(N-acetyl-3-aminoanilino)-2-cyanoprop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)/C(C#N)=C\N(C(C)=O)c1cccc(N)c1)C(=O)O |
| InChI | InChI=1S/C17H20N4O4S/c1-11(22)21(14-5-3-4-13(19)8-14)10-12(9-18)16(23)20-15(17(24)25)6-7-26-2/h3-5,8,10,15H,6-7,19H2,1-2H3,(H,20,23)(H,24,25)/b12-10- |
| InChIKey | ZLSOHWJERBJNFS-BENRWUELSA-N |
| XLogP | 1.35 |
| TPSA | 136.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|