C20H20FN3O3 — CID 108847001
(Z)-2-cyano-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-(4-fluoroanilino)prop-2-enamide (PubChem CID 108847001) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is (Z)-2-cyano-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-(4-fluoroanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-(4-fluoroanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108847001 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (Z)-2-cyano-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-(4-fluoroanilino)prop-2-enamide |
| SMILES | COc1ccc(C(C)NC(=O)/C(C#N)=C\Nc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C20H20FN3O3/c1-13(14-4-9-18(26-2)19(10-14)27-3)24-20(25)15(11-22)12-23-17-7-5-16(21)6-8-17/h4-10,12-13,23H,1-3H3,(H,24,25)/b15-12- |
| InChIKey | JFUOBKYZKZMXNR-QINSGFPZSA-N |
| XLogP | 3.54 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|