C22H26N4O3 — CID 108847131
(Z)-2-cyano-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-[3-(dimethylamino)anilino]prop-2-enamide (PubChem CID 108847131) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is (Z)-2-cyano-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-[3-(dimethylamino)anilino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-[3-(dimethylamino)anilino]prop-2-enamide |
|---|---|
| PubChem CID | 108847131 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (Z)-2-cyano-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-[3-(dimethylamino)anilino]prop-2-enamide |
| SMILES | COc1ccc(C(C)NC(=O)/C(C#N)=C\Nc2cccc(N(C)C)c2)cc1OC |
| InChI | InChI=1S/C22H26N4O3/c1-15(16-9-10-20(28-4)21(11-16)29-5)25-22(27)17(13-23)14-24-18-7-6-8-19(12-18)26(2)3/h6-12,14-15,24H,1-5H3,(H,25,27)/b17-14- |
| InChIKey | RRSRUTQKDVTHNB-VKAVYKQESA-N |
| XLogP | 3.47 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|