C7H7NO4 — CID 1088479
(2R)-2-(2,5-dioxopyrrol-1-yl)propanoic acid (PubChem CID 1088479) has the molecular formula C7H7NO4 and a molecular weight of 169.14 g/mol. Its IUPAC name is (2R)-2-(2,5-dioxopyrrol-1-yl)propanoic acid.
| Compound Name | (2R)-2-(2,5-dioxopyrrol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 1088479 |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | (2R)-2-(2,5-dioxopyrrol-1-yl)propanoic acid |
| SMILES | C[C@H](C(=O)O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H7NO4/c1-4(7(11)12)8-5(9)2-3-6(8)10/h2-4H,1H3,(H,11,12)/t4-/m1/s1 |
| InChIKey | MDNSLPICAWKNAG-SCSAIBSYSA-N |
| XLogP | -0.62 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|