C7H7NO4 — CID 22403517
2-(3-methyl-2,5-dioxopyrrol-1-yl)acetic acid (PubChem CID 22403517) has the molecular formula C7H7NO4 and a molecular weight of 169.14 g/mol. Its IUPAC name is 2-(3-methyl-2,5-dioxopyrrol-1-yl)acetic acid.
| Compound Name | 2-(3-methyl-2,5-dioxopyrrol-1-yl)acetic acid |
|---|---|
| PubChem CID | 22403517 |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | 2-(3-methyl-2,5-dioxopyrrol-1-yl)acetic acid |
| SMILES | CC1=CC(=O)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C7H7NO4/c1-4-2-5(9)8(7(4)12)3-6(10)11/h2H,3H2,1H3,(H,10,11) |
| InChIKey | GAOKXSIWDUODDM-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|