C8H9NO4 — CID 22403507
2-(3-methyl-2,5-dioxopyrrol-1-yl)propanoic acid (PubChem CID 22403507) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is 2-(3-methyl-2,5-dioxopyrrol-1-yl)propanoic acid.
| Compound Name | 2-(3-methyl-2,5-dioxopyrrol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 22403507 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 2-(3-methyl-2,5-dioxopyrrol-1-yl)propanoic acid |
| SMILES | CC1=CC(=O)N(C(C)C(=O)O)C1=O |
| InChI | InChI=1S/C8H9NO4/c1-4-3-6(10)9(7(4)11)5(2)8(12)13/h3,5H,1-2H3,(H,12,13) |
| InChIKey | KFNDPFDGAFSNEH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|