C21H41ClO4Si2 — CID 10884836
(2R,3aR,7aR)-2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-chloro-3a-trimethylsilyloxy-5,6,7,7a-tetrahydro-4H-1-benzofuran-3-one (PubChem CID 10884836) has the molecular formula C21H41ClO4Si2 and a molecular weight of 449.18 g/mol. Its IUPAC name is (2R,3aR,7aR)-2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-chloro-3a-trimethylsilyloxy-5,6,7,7a-tetrahydro-4H-1-benzofuran-3-one.
| Compound Name | (2R,3aR,7aR)-2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-chloro-3a-trimethylsilyloxy-5,6,7,7a-tetrahydro-4H-1-benzofuran-3-one |
|---|---|
| PubChem CID | 10884836 |
| Molecular Formula | C21H41ClO4Si2 |
| Molecular Weight | 449.18 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | (2R,3aR,7aR)-2-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-chloro-3a-trimethylsilyloxy-5,6,7,7a-tetrahydro-4H-1-benzofuran-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC[C@]1(Cl)O[C@@H]2CCCC[C@]2(O[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C21H41ClO4Si2/c1-19(2,3)28(7,8)24-16-12-11-15-21(22)18(23)20(26-27(4,5)6)14-10-9-13-17(20)25-21/h17H,9-16H2,1-8H3/t17-,20-,21+/m1/s1 |
| InChIKey | OBCNAUZCOZJHOR-UIFIKXQLSA-N |
| XLogP | 6.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.18 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|