C20H27N3O2 — CID 108848956
(Z)-2-cyano-3-[ethyl(2-hydroxyethyl)amino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide (PubChem CID 108848956) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is (Z)-2-cyano-3-[ethyl(2-hydroxyethyl)amino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[ethyl(2-hydroxyethyl)amino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108848956 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (Z)-2-cyano-3-[ethyl(2-hydroxyethyl)amino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]prop-2-enamide |
| SMILES | CCN(/C=C(/C#N)C(=O)NC(C)c1ccc2c(c1)CCCC2)CCO |
| InChI | InChI=1S/C20H27N3O2/c1-3-23(10-11-24)14-19(13-21)20(25)22-15(2)17-9-8-16-6-4-5-7-18(16)12-17/h8-9,12,14-15,24H,3-7,10-11H2,1-2H3,(H,22,25)/b19-14- |
| InChIKey | DACKQZLYRJWWDQ-RGEXLXHISA-N |
| XLogP | 2.46 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|