C23H36N4O7 — CID 10885309
(3S)-7-amino-3-[[(2S)-1-[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-2,5-dihydropyrrole-2-carbonyl]amino]-2-oxoheptanoic acid (PubChem CID 10885309) has the molecular formula C23H36N4O7 and a molecular weight of 480.56 g/mol. Its IUPAC name is (3S)-7-amino-3-[[(2S)-1-[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-2,5-dihydropyrrole-2-carbonyl]amino]-2-oxoheptanoic acid.
| Compound Name | (3S)-7-amino-3-[[(2S)-1-[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-2,5-dihydropyrrole-2-carbonyl]amino]-2-oxoheptanoic acid |
|---|---|
| PubChem CID | 10885309 |
| Molecular Formula | C23H36N4O7 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | (3S)-7-amino-3-[[(2S)-1-[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-2,5-dihydropyrrole-2-carbonyl]amino]-2-oxoheptanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@@H]1C=CCN1C(=O)[C@@H](CC1CCCCC1)NCC(=O)O)C(=O)C(=O)O |
| InChI | InChI=1S/C23H36N4O7/c24-11-5-4-9-16(20(30)23(33)34)26-21(31)18-10-6-12-27(18)22(32)17(25-14-19(28)29)13-15-7-2-1-3-8-15/h6,10,15-18,25H,1-5,7-9,11-14,24H2,(H,26,31)(H,28,29)(H,33,34)/t16-,17+,18-/m0/s1 |
| InChIKey | ITQNWOLLNYNACX-KSZLIROESA-N |
| XLogP | 0.03 |
| TPSA | 179.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|