C25H42N4O7 — CID 11049487
(3S)-7-amino-3-[[2-[[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-cyclopentylamino]acetyl]amino]-2-oxoheptanoic acid (PubChem CID 11049487) has the molecular formula C25H42N4O7 and a molecular weight of 510.63 g/mol. Its IUPAC name is (3S)-7-amino-3-[[2-[[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-cyclopentylamino]acetyl]amino]-2-oxoheptanoic acid.
| Compound Name | (3S)-7-amino-3-[[2-[[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-cyclopentylamino]acetyl]amino]-2-oxoheptanoic acid |
|---|---|
| PubChem CID | 11049487 |
| Molecular Formula | C25H42N4O7 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | (3S)-7-amino-3-[[2-[[(2R)-2-(carboxymethylamino)-3-cyclohexylpropanoyl]-cyclopentylamino]acetyl]amino]-2-oxoheptanoic acid |
| SMILES | NCCCC[C@H](NC(=O)CN(C(=O)[C@@H](CC1CCCCC1)NCC(=O)O)C1CCCC1)C(=O)C(=O)O |
| InChI | InChI=1S/C25H42N4O7/c26-13-7-6-12-19(23(33)25(35)36)28-21(30)16-29(18-10-4-5-11-18)24(34)20(27-15-22(31)32)14-17-8-2-1-3-9-17/h17-20,27H,1-16,26H2,(H,28,30)(H,31,32)(H,35,36)/t19-,20+/m0/s1 |
| InChIKey | BKVHHNCGQAGLEV-VQTJNVASSA-N |
| XLogP | 1.04 |
| TPSA | 179.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|