C17H13BrN4O3 — CID 108853197
(Z)-3-[(3-bromophenyl)methylamino]-2-cyano-N-(4-nitrophenyl)prop-2-enamide (PubChem CID 108853197) has the molecular formula C17H13BrN4O3 and a molecular weight of 401.22 g/mol. Its IUPAC name is (Z)-3-[(3-bromophenyl)methylamino]-2-cyano-N-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[(3-bromophenyl)methylamino]-2-cyano-N-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108853197 |
| Molecular Formula | C17H13BrN4O3 |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | (Z)-3-[(3-bromophenyl)methylamino]-2-cyano-N-(4-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/NCc1cccc(Br)c1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H13BrN4O3/c18-14-3-1-2-12(8-14)10-20-11-13(9-19)17(23)21-15-4-6-16(7-5-15)22(24)25/h1-8,11,20H,10H2,(H,21,23)/b13-11- |
| InChIKey | GNOWGJHAFMUQAQ-QBFSEMIESA-N |
| XLogP | 3.49 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|