C23H18BrN3O2 — CID 108849850
(Z)-3-[(3-bromophenyl)methylamino]-2-cyano-N-(4-phenoxyphenyl)prop-2-enamide (PubChem CID 108849850) has the molecular formula C23H18BrN3O2 and a molecular weight of 448.32 g/mol. Its IUPAC name is (Z)-3-[(3-bromophenyl)methylamino]-2-cyano-N-(4-phenoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[(3-bromophenyl)methylamino]-2-cyano-N-(4-phenoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108849850 |
| Molecular Formula | C23H18BrN3O2 |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | (Z)-3-[(3-bromophenyl)methylamino]-2-cyano-N-(4-phenoxyphenyl)prop-2-enamide |
| SMILES | N#C/C(=C/NCc1cccc(Br)c1)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H18BrN3O2/c24-19-6-4-5-17(13-19)15-26-16-18(14-25)23(28)27-20-9-11-22(12-10-20)29-21-7-2-1-3-8-21/h1-13,16,26H,15H2,(H,27,28)/b18-16- |
| InChIKey | BRSQKEYGUASJHU-VLGSPTGOSA-N |
| XLogP | 5.38 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|