C18H14N4O5 — CID 108853304
(Z)-3-(1,3-benzodioxol-5-ylmethylamino)-2-cyano-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 108853304) has the molecular formula C18H14N4O5 and a molecular weight of 366.33 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-5-ylmethylamino)-2-cyano-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-3-(1,3-benzodioxol-5-ylmethylamino)-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108853304 |
| Molecular Formula | C18H14N4O5 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-ylmethylamino)-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/NCc1ccc2c(c1)OCO2)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14N4O5/c19-8-13(18(23)21-14-2-1-3-15(7-14)22(24)25)10-20-9-12-4-5-16-17(6-12)27-11-26-16/h1-7,10,20H,9,11H2,(H,21,23)/b13-10- |
| InChIKey | QVVLMRZKYAHLRV-RAXLEYEMSA-N |
| XLogP | 2.46 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|