C15H10ClN5O3 — CID 108853590
(Z)-3-[(4-chloro-2-pyridinyl)amino]-2-cyano-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 108853590) has the molecular formula C15H10ClN5O3 and a molecular weight of 343.73 g/mol. Its IUPAC name is (Z)-3-[(4-chloro-2-pyridinyl)amino]-2-cyano-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[(4-chloro-2-pyridinyl)amino]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108853590 |
| Molecular Formula | C15H10ClN5O3 |
| Molecular Weight | 343.73 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | (Z)-3-[(4-chloro-2-pyridinyl)amino]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1cc(Cl)ccn1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10ClN5O3/c16-11-4-5-18-14(6-11)19-9-10(8-17)15(22)20-12-2-1-3-13(7-12)21(23)24/h1-7,9H,(H,18,19)(H,20,22)/b10-9- |
| InChIKey | VXZLXPABTLTFBO-KTKRTIGZSA-N |
| XLogP | 3.10 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.73 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|