C19H21N3O — CID 108861210
(Z)-2-cyano-3-(3,4-dihydro-1H-isoquinolin-2-yl)-N,N-bis(prop-2-enyl)prop-2-enamide (PubChem CID 108861210) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,4-dihydro-1H-isoquinolin-2-yl)-N,N-bis(prop-2-enyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3,4-dihydro-1H-isoquinolin-2-yl)-N,N-bis(prop-2-enyl)prop-2-enamide |
|---|---|
| PubChem CID | 108861210 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (Z)-2-cyano-3-(3,4-dihydro-1H-isoquinolin-2-yl)-N,N-bis(prop-2-enyl)prop-2-enamide |
| SMILES | C=CCN(CC=C)C(=O)/C(C#N)=C\N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H21N3O/c1-3-10-22(11-4-2)19(23)18(13-20)15-21-12-9-16-7-5-6-8-17(16)14-21/h3-8,15H,1-2,9-12,14H2/b18-15- |
| InChIKey | ONHNTVLHYHLPRN-SDXDJHTJSA-N |
| XLogP | 2.65 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|