C14H23N5O3 — CID 108862131
ethyl N-[2-[[(Z)-2-cyano-3-(4-methylpiperazin-1-yl)-3-oxoprop-1-enyl]amino]ethyl]carbamate (PubChem CID 108862131) has the molecular formula C14H23N5O3 and a molecular weight of 309.37 g/mol. Its IUPAC name is ethyl N-[2-[[(Z)-2-cyano-3-(4-methylpiperazin-1-yl)-3-oxoprop-1-enyl]amino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[[(Z)-2-cyano-3-(4-methylpiperazin-1-yl)-3-oxoprop-1-enyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108862131 |
| Molecular Formula | C14H23N5O3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | ethyl N-[2-[[(Z)-2-cyano-3-(4-methylpiperazin-1-yl)-3-oxoprop-1-enyl]amino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCN/C=C(/C#N)C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C14H23N5O3/c1-3-22-14(21)17-5-4-16-11-12(10-15)13(20)19-8-6-18(2)7-9-19/h11,16H,3-9H2,1-2H3,(H,17,21)/b12-11- |
| InChIKey | RUWILALHCCDGTE-QXMHVHEDSA-N |
| XLogP | -0.50 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|