C15H25N5O4 — CID 108863250
ethyl N-[2-[[(Z)-2-cyano-3-(2-morpholin-4-ylethylamino)-3-oxoprop-1-enyl]amino]ethyl]carbamate (PubChem CID 108863250) has the molecular formula C15H25N5O4 and a molecular weight of 339.40 g/mol. Its IUPAC name is ethyl N-[2-[[(Z)-2-cyano-3-(2-morpholin-4-ylethylamino)-3-oxoprop-1-enyl]amino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[[(Z)-2-cyano-3-(2-morpholin-4-ylethylamino)-3-oxoprop-1-enyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108863250 |
| Molecular Formula | C15H25N5O4 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | ethyl N-[2-[[(Z)-2-cyano-3-(2-morpholin-4-ylethylamino)-3-oxoprop-1-enyl]amino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCN/C=C(/C#N)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C15H25N5O4/c1-2-24-15(22)19-4-3-17-12-13(11-16)14(21)18-5-6-20-7-9-23-10-8-20/h12,17H,2-10H2,1H3,(H,18,21)(H,19,22)/b13-12- |
| InChIKey | KPSDUQKLFBKVGT-SEYXRHQNSA-N |
| XLogP | -0.82 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|