C16H29N5O2 — CID 108863993
(Z)-2-cyano-N-(2-piperazin-1-ylethyl)-3-(3-propan-2-yloxypropylamino)prop-2-enamide (PubChem CID 108863993) has the molecular formula C16H29N5O2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2-piperazin-1-ylethyl)-3-(3-propan-2-yloxypropylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2-piperazin-1-ylethyl)-3-(3-propan-2-yloxypropylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108863993 |
| Molecular Formula | C16H29N5O2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | (Z)-2-cyano-N-(2-piperazin-1-ylethyl)-3-(3-propan-2-yloxypropylamino)prop-2-enamide |
| SMILES | CC(C)OCCCN/C=C(/C#N)C(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C16H29N5O2/c1-14(2)23-11-3-4-19-13-15(12-17)16(22)20-7-10-21-8-5-18-6-9-21/h13-14,18-19H,3-11H2,1-2H3,(H,20,22)/b15-13- |
| InChIKey | NAOYGGZJMCEALZ-SQFISAMPSA-N |
| XLogP | -0.18 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|