C14H26N4O4 — CID 108864367
tert-butyl N-[2-[(4-acetylpiperazine-1-carbonyl)amino]ethyl]carbamate (PubChem CID 108864367) has the molecular formula C14H26N4O4 and a molecular weight of 314.39 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-acetylpiperazine-1-carbonyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-acetylpiperazine-1-carbonyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108864367 |
| Molecular Formula | C14H26N4O4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | tert-butyl N-[2-[(4-acetylpiperazine-1-carbonyl)amino]ethyl]carbamate |
| SMILES | CC(=O)N1CCN(C(=O)NCCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H26N4O4/c1-11(19)17-7-9-18(10-8-17)12(20)15-5-6-16-13(21)22-14(2,3)4/h5-10H2,1-4H3,(H,15,20)(H,16,21) |
| InChIKey | BNGWZXHIPKPSBW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|