C30H26N8O2S2 — CID 10886489
3-[[2-tert-butyl-4-[(6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)methoxy]phenoxy]methyl]-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 10886489) has the molecular formula C30H26N8O2S2 and a molecular weight of 594.73 g/mol. Its IUPAC name is 3-[[2-tert-butyl-4-[(6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)methoxy]phenoxy]methyl]-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-[[2-tert-butyl-4-[(6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)methoxy]phenoxy]methyl]-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 10886489 |
| Molecular Formula | C30H26N8O2S2 |
| Molecular Weight | 594.73 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | 3-[[2-tert-butyl-4-[(6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl)methoxy]phenoxy]methyl]-6-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | CC(C)(C)c1cc(OCc2nnc3sc(-c4ccccc4)nn23)ccc1OCc1nnc2sc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C30H26N8O2S2/c1-30(2,3)22-16-21(39-17-24-31-33-28-37(24)35-26(41-28)19-10-6-4-7-11-19)14-15-23(22)40-18-25-32-34-29-38(25)36-27(42-29)20-12-8-5-9-13-20/h4-16H,17-18H2,1-3H3 |
| InChIKey | ZQVVVKWGRXLFGH-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 104.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.73 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |