C35H50O6Si — CID 10886493
(1S,5S,6R,7S,10R,12S,13S)-12-[tert-butyl(dimethyl)silyl]oxy-13,17,20,20-tetramethyl-15-methylidene-7-phenylmethoxy-2,4,9-trioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-3-one (PubChem CID 10886493) has the molecular formula C35H50O6Si and a molecular weight of 594.87 g/mol. Its IUPAC name is (1S,5S,6R,7S,10R,12S,13S)-12-[tert-butyl(dimethyl)silyl]oxy-13,17,20,20-tetramethyl-15-methylidene-7-phenylmethoxy-2,4,9-trioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-3-one.
| Compound Name | (1S,5S,6R,7S,10R,12S,13S)-12-[tert-butyl(dimethyl)silyl]oxy-13,17,20,20-tetramethyl-15-methylidene-7-phenylmethoxy-2,4,9-trioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-3-one |
|---|---|
| PubChem CID | 10886493 |
| Molecular Formula | C35H50O6Si |
| Molecular Weight | 594.87 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | (1S,5S,6R,7S,10R,12S,13S)-12-[tert-butyl(dimethyl)silyl]oxy-13,17,20,20-tetramethyl-15-methylidene-7-phenylmethoxy-2,4,9-trioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-3-one |
| SMILES | C=C1C[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]3OC[C@@]3(OCc3ccccc3)[C@H]2[C@@H]2OC(=O)O[C@]23CCC(C)=C1C3(C)C |
| InChI | InChI=1S/C35H50O6Si/c1-22-16-17-35-29(39-30(36)40-35)28-33(8,19-23(2)27(22)32(35,6)7)25(41-42(9,10)31(3,4)5)18-26-34(28,21-37-26)38-20-24-14-12-11-13-15-24/h11-15,25-26,28-29H,2,16-21H2,1,3-10H3/t25-,26+,28-,29-,33+,34-,35+/m0/s1 |
| InChIKey | CNHKOFMJMRLOQN-MFVRZSLKSA-N |
| XLogP | 8.13 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.87 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|