C30H63NO6Si3 — CID 10886648
tert-butyl (5R)-2-oxo-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]pyrrolidine-1-carboxylate (PubChem CID 10886648) has the molecular formula C30H63NO6Si3 and a molecular weight of 618.09 g/mol. Its IUPAC name is tert-butyl (5R)-2-oxo-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5R)-2-oxo-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10886648 |
| Molecular Formula | C30H63NO6Si3 |
| Molecular Weight | 618.09 g/mol |
| Exact Mass | 617.40 |
| IUPAC Name | tert-butyl (5R)-2-oxo-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H63NO6Si3/c1-27(2,3)35-26(33)31-22(19-20-24(31)32)25(37-40(17,18)30(10,11)12)23(36-39(15,16)29(7,8)9)21-34-38(13,14)28(4,5)6/h22-23,25H,19-21H2,1-18H3/t22-,23-,25+/m1/s1 |
| InChIKey | HNHRZUKWYSPIMK-OYRHQHFDSA-N |
| XLogP | 8.72 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.09 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|