C19H23FN2O2 — CID 108867649
1-[1-(2-ethoxy-5-methylphenyl)ethyl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 108867649) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is 1-[1-(2-ethoxy-5-methylphenyl)ethyl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[1-(2-ethoxy-5-methylphenyl)ethyl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 108867649 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[1-(2-ethoxy-5-methylphenyl)ethyl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | CCOc1ccc(C)cc1C(C)NC(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H23FN2O2/c1-4-24-18-10-5-13(2)11-17(18)14(3)22-19(23)21-12-15-6-8-16(20)9-7-15/h5-11,14H,4,12H2,1-3H3,(H2,21,22,23) |
| InChIKey | REWZUGUDFZMKOJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |