C19H22N2O4 — CID 122017293
4-[[[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]carbamoylamino]methyl]benzoic acid (PubChem CID 122017293) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-[[[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]carbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]carbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122017293 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 4-[[[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]carbamoylamino]methyl]benzoic acid |
| SMILES | COc1ccc(C)cc1[C@@H](C)NC(=O)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H22N2O4/c1-12-4-9-17(25-3)16(10-12)13(2)21-19(24)20-11-14-5-7-15(8-6-14)18(22)23/h4-10,13H,11H2,1-3H3,(H,22,23)(H2,20,21,24)/t13-/m1/s1 |
| InChIKey | RYLFRBDETUFMGZ-CYBMUJFWSA-N |
| XLogP | 3.26 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |