C19H22N2O3 — CID 122017519
4-[[1-(3,4-dimethylphenyl)ethylcarbamoylamino]methyl]benzoic acid (PubChem CID 122017519) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-[[1-(3,4-dimethylphenyl)ethylcarbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[1-(3,4-dimethylphenyl)ethylcarbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122017519 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 4-[[1-(3,4-dimethylphenyl)ethylcarbamoylamino]methyl]benzoic acid |
| SMILES | Cc1ccc(C(C)NC(=O)NCc2ccc(C(=O)O)cc2)cc1C |
| InChI | InChI=1S/C19H22N2O3/c1-12-4-7-17(10-13(12)2)14(3)21-19(24)20-11-15-5-8-16(9-6-15)18(22)23/h4-10,14H,11H2,1-3H3,(H,22,23)(H2,20,21,24) |
| InChIKey | HFIMJDVCHVWGDS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |