C20H24N2O4 — CID 108880613
4-[[1-(4-propan-2-ylphenoxy)ethylcarbamoylamino]methyl]benzoic acid (PubChem CID 108880613) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 4-[[1-(4-propan-2-ylphenoxy)ethylcarbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[1-(4-propan-2-ylphenoxy)ethylcarbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 108880613 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-[[1-(4-propan-2-ylphenoxy)ethylcarbamoylamino]methyl]benzoic acid |
| SMILES | CC(NC(=O)NCc1ccc(C(=O)O)cc1)Oc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C20H24N2O4/c1-13(2)16-8-10-18(11-9-16)26-14(3)22-20(25)21-12-15-4-6-17(7-5-15)19(23)24/h4-11,13-14H,12H2,1-3H3,(H,23,24)(H2,21,22,25) |
| InChIKey | RYWSKHSPHBSMDN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|