C18H20N2O5 — CID 108871239
methyl 4-[[1-(4-hydroxyphenoxy)ethylcarbamoylamino]methyl]benzoate (PubChem CID 108871239) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is methyl 4-[[1-(4-hydroxyphenoxy)ethylcarbamoylamino]methyl]benzoate.
| Compound Name | methyl 4-[[1-(4-hydroxyphenoxy)ethylcarbamoylamino]methyl]benzoate |
|---|---|
| PubChem CID | 108871239 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | methyl 4-[[1-(4-hydroxyphenoxy)ethylcarbamoylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)NC(C)Oc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C18H20N2O5/c1-12(25-16-9-7-15(21)8-10-16)20-18(23)19-11-13-3-5-14(6-4-13)17(22)24-2/h3-10,12,21H,11H2,1-2H3,(H2,19,20,23) |
| InChIKey | CFROZRHMUQQFEI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|