C16H25N3O5 — CID 108871280
tert-butyl N-[2-[1-(4-hydroxyphenoxy)ethylcarbamoylamino]ethyl]carbamate (PubChem CID 108871280) has the molecular formula C16H25N3O5 and a molecular weight of 339.39 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(4-hydroxyphenoxy)ethylcarbamoylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(4-hydroxyphenoxy)ethylcarbamoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108871280 |
| Molecular Formula | C16H25N3O5 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | tert-butyl N-[2-[1-(4-hydroxyphenoxy)ethylcarbamoylamino]ethyl]carbamate |
| SMILES | CC(NC(=O)NCCNC(=O)OC(C)(C)C)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C16H25N3O5/c1-11(23-13-7-5-12(20)6-8-13)19-14(21)17-9-10-18-15(22)24-16(2,3)4/h5-8,11,20H,9-10H2,1-4H3,(H,18,22)(H2,17,19,21) |
| InChIKey | BUCOSOLTRWHRJM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|