C18H27N3O6 — CID 108537115
tert-butyl N-[2-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethylamino]-2-oxoethyl]carbamate (PubChem CID 108537115) has the molecular formula C18H27N3O6 and a molecular weight of 381.43 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108537115 |
| Molecular Formula | C18H27N3O6 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | tert-butyl N-[2-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethylamino]-2-oxoethyl]carbamate |
| SMILES | CC(Oc1ccc(O)cc1)C(=O)NCCNC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27N3O6/c1-12(26-14-7-5-13(22)6-8-14)16(24)20-10-9-19-15(23)11-21-17(25)27-18(2,3)4/h5-8,12,22H,9-11H2,1-4H3,(H,19,23)(H,20,24)(H,21,25) |
| InChIKey | GKNXCFVXZUSVRJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|