C25H33N3O5 — CID 108917148
tert-butyl N-[2-oxo-2-[3-[2-(4-propan-2-ylphenoxy)propanoylamino]anilino]ethyl]carbamate (PubChem CID 108917148) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[3-[2-(4-propan-2-ylphenoxy)propanoylamino]anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[3-[2-(4-propan-2-ylphenoxy)propanoylamino]anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 108917148 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[3-[2-(4-propan-2-ylphenoxy)propanoylamino]anilino]ethyl]carbamate |
| SMILES | CC(Oc1ccc(C(C)C)cc1)C(=O)Nc1cccc(NC(=O)CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C25H33N3O5/c1-16(2)18-10-12-21(13-11-18)32-17(3)23(30)28-20-9-7-8-19(14-20)27-22(29)15-26-24(31)33-25(4,5)6/h7-14,16-17H,15H2,1-6H3,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | MDBRICOGKWQGNW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |