C17H27N3O4 — CID 108880818
ethyl N-[2-[1-(4-propan-2-ylphenoxy)ethylcarbamoylamino]ethyl]carbamate (PubChem CID 108880818) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is ethyl N-[2-[1-(4-propan-2-ylphenoxy)ethylcarbamoylamino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[1-(4-propan-2-ylphenoxy)ethylcarbamoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108880818 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | ethyl N-[2-[1-(4-propan-2-ylphenoxy)ethylcarbamoylamino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)NC(C)Oc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C17H27N3O4/c1-5-23-17(22)19-11-10-18-16(21)20-13(4)24-15-8-6-14(7-9-15)12(2)3/h6-9,12-13H,5,10-11H2,1-4H3,(H,19,22)(H2,18,20,21) |
| InChIKey | HVVNVKPZEBMKAI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|