C13H19NO4S — CID 146613721
tert-butyl N-[2-(4-hydroxyphenyl)sulfinylethyl]carbamate (PubChem CID 146613721) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is tert-butyl N-[2-(4-hydroxyphenyl)sulfinylethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-hydroxyphenyl)sulfinylethyl]carbamate |
|---|---|
| PubChem CID | 146613721 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | tert-butyl N-[2-(4-hydroxyphenyl)sulfinylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCS(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H19NO4S/c1-13(2,3)18-12(16)14-8-9-19(17)11-6-4-10(15)5-7-11/h4-7,15H,8-9H2,1-3H3,(H,14,16) |
| InChIKey | LLMJIZBPHAJHRD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |